CAS 64037-12-3 appears in our catalog under these names: 5,6-Dichloro-1,3-benzoxazol-2-amine, 98%, 5,6-Dichloro-1,3-benzoxazol-2-amine, >95% (HPLC), 5,6-Dichlorobenzo(d)oxazol-2-amine, 98%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 5g, 100mg.
5,6-dichloro-1,3-benzoxazol-2-amine (CAS 64037-12-3) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 5,6-dichloro-1,3-benzoxazol-2-amine. InChIKey: IHWQUKMGROAAEH-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 5,6-dichloro-1,3-benzoxazol-2-amine |
| InChIKey | IHWQUKMGROAAEH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)OC(=N2)N |
Computed by PubChem (NCBI)