CAS 98555-67-0 appears in our catalog under these names: 5,7-Dichloro-1,3-benzoxazol-2-amine, 95%, 5,7-Dichloro-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
5,7-dichloro-1,3-benzoxazol-2-amine (CAS 98555-67-0) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 5,7-dichloro-1,3-benzoxazol-2-amine. InChIKey: NHDNAMKNESMSDH-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 5,7-dichloro-1,3-benzoxazol-2-amine |
| InChIKey | NHDNAMKNESMSDH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)Cl)Cl |
Computed by PubChem (NCBI)