CAS 2565712-86-7 is the registry number for 5,6-Dichloro-1H-indazol-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-1H-indazol-4-ol (CAS 2565712-86-7) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 5,6-dichloro-1H-indazol-4-ol. InChIKey: PKCYMXUHGXJWFG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 5,6-dichloro-1H-indazol-4-ol |
| InChIKey | PKCYMXUHGXJWFG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Cl)Cl)O)C=NN2 |
Computed by PubChem (NCBI)