CAS 1190318-74-1 is the registry number for 2-Oxo-2,3-dihydro-1H-pyrrolo(3,2-b)pyridine-6-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-6-carboxylic acid (CAS 1190318-74-1) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-6-carboxylic acid. InChIKey: CGYZCBDNBHYSSU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-6-carboxylic acid |
| InChIKey | CGYZCBDNBHYSSU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)