Products 1190318-92-3
CAS 1190318-92-3 appears in our catalog under these names: 6-Aza-2-oxindole-7-carboxylic Acid, 98%, 98%, 2-Oxo-2,3-dihydro-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg.
2-oxo-1,3-dihydropyrrolo[2,3-c]pyridine-7-carboxylic acid (CAS 1190318-92-3) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-oxo-1,3-dihydropyrrolo[2,3-c]pyridine-7-carboxylic acid. InChIKey: YNTBLLDKTXYDPN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-oxo-1,3-dihydropyrrolo[2,3-c]pyridine-7-carboxylic acid |
| InChIKey | YNTBLLDKTXYDPN-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=NC=C2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)