Products 1191245-18-7
CAS 1191245-18-7 is the registry number for (2E)-N-(2-Bromophenyl)-2-(hydroxyimino)acetamide. Offered by: Biosynth. Available pack sizes: 5g.
(2E)-N-(2-bromophenyl)-2-hydroxyiminoacetamide (CAS 1191245-18-7) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: (2E)-N-(2-bromophenyl)-2-hydroxyiminoacetamide. InChIKey: KRUQMJREXXFSBT-BJMVGYQFSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | (2E)-N-(2-bromophenyl)-2-hydroxyiminoacetamide |
| InChIKey | KRUQMJREXXFSBT-BJMVGYQFSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)/C=N/O)Br |
Computed by PubChem (NCBI)