Products 1192107-41-7
CAS 1192107-41-7 appears in our catalog under these names: 4-Isopropoxy-2,6-dimethylphenylboronic acid, 95%, (4-Isopropoxy-2,6-dimethylphenyl)boronic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(2,6-dimethyl-4-propan-2-yloxyphenyl)boronic acid (CAS 1192107-41-7) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (2,6-dimethyl-4-propan-2-yloxyphenyl)boronic acid. InChIKey: CDLOENHMDAFPEK-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (2,6-dimethyl-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | CDLOENHMDAFPEK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)OC(C)C)C)(O)O |
Computed by PubChem (NCBI)