CAS 1192656-20-4 is the registry number for 5-(((3-Chlorophenyl)amino)methyl)-1H-1,2,4-triazol-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3-chloroanilino)methyl]-1,4-dihydro-1,2,4-triazol-5-one (CAS 1192656-20-4) is a chemical compound with the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. IUPAC name: 3-[(3-chloroanilino)methyl]-1,4-dihydro-1,2,4-triazol-5-one. InChIKey: WFLCJMJJWMIPTK-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | 3-[(3-chloroanilino)methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| InChIKey | WFLCJMJJWMIPTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NCC2=NNC(=O)N2 |
Computed by PubChem (NCBI)