CAS 2387598-42-5 is the registry number for 1-(4-Chloro-7-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)cyclopropan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chloro-7-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)cyclopropan-1-ol (CAS 2387598-42-5) is a chemical compound with the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. IUPAC name: 1-(4-chloro-7-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)cyclopropan-1-ol. InChIKey: FOPNANRITHTPMM-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | 1-(4-chloro-7-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)cyclopropan-1-ol |
| InChIKey | FOPNANRITHTPMM-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(N=C2Cl)C3(CC3)O |
Computed by PubChem (NCBI)