CAS 1259059-74-9 appears in our catalog under these names: (R)-1-(2-Chlorophenyl)-2-(1H-tetrazol-1-yl)ethan-1-ol, (αR)-α-(2-Chlorophenyl)-1H-tetrazole-1-ethanol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,5g, 0,25g, 1g.
(1R)-1-(2-chlorophenyl)-2-(tetrazol-1-yl)ethanol (CAS 1259059-74-9) is a chemical compound with the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. IUPAC name: (1R)-1-(2-chlorophenyl)-2-(tetrazol-1-yl)ethanol. InChIKey: HCZWDYYFCFSOHJ-VIFPVBQESA-N.
| Molecular formula | C9H9ClN4O |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | (1R)-1-(2-chlorophenyl)-2-(tetrazol-1-yl)ethanol |
| InChIKey | HCZWDYYFCFSOHJ-VIFPVBQESA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CN2C=NN=N2)O)Cl |
Computed by PubChem (NCBI)