CAS 736941-80-3 is the registry number for 2-(((4H-1,2,4-Triazol-4-yl)amino)methyl)-4-chlorophenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-[(1,2,4-triazol-4-ylamino)methyl]phenol (CAS 736941-80-3) is a chemical compound with the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. IUPAC name: 4-chloro-2-[(1,2,4-triazol-4-ylamino)methyl]phenol. InChIKey: DXHHDPYDOJGYAV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | 4-chloro-2-[(1,2,4-triazol-4-ylamino)methyl]phenol |
| InChIKey | DXHHDPYDOJGYAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CNN2C=NN=C2)O |
Computed by PubChem (NCBI)