CAS 1638765-25-9 is the registry number for 2-Chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide (CAS 1638765-25-9) is a chemical compound with the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. IUPAC name: 2-chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide. InChIKey: DEOFCSXPXFLVCE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | 2-chloro-N,N-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| InChIKey | DEOFCSXPXFLVCE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC2=CN=C(N=C2N1)Cl |
Computed by PubChem (NCBI)