CAS 1259059-77-2 appears in our catalog under these names: (R)-1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)ethan-1-ol, 97%, 97%, (αR)-α-(2-Chlorophenyl)-2H-tetrazole-2-ethanolÂ, Benzonatate Impurity 4. Offered by: Chemat, Biosynth, Chemat Brand. Available pack sizes: 100mg, 250mg, 10g, 5g, 25g, 50g, on request.
(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethanol (CAS 1259059-77-2) is a chemical compound with the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. IUPAC name: (1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethanol. InChIKey: HMTCTAFOMZTQMS-VIFPVBQESA-N.
| Molecular formula | C9H9ClN4O |
|---|---|
| Molecular weight | 224.65 g/mol |
| IUPAC name | (1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethanol |
| InChIKey | HMTCTAFOMZTQMS-VIFPVBQESA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CN2N=CN=N2)O)Cl |
Computed by PubChem (NCBI)