Products 1192765-24-4
CAS 1192765-24-4 appears in our catalog under these names: ethyl 4–(5，5–dimethyl–1，3，2–dioxaborinan–2–yl)benzoate, ethyl 4-(5，5-dimethyl-1，3，2-dioxaborinan-2-yl)benzoate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
Ethyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate (CAS 1192765-24-4) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: ethyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate. InChIKey: CPDLLPFTQXWMPN-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | ethyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate |
| InChIKey | CPDLLPFTQXWMPN-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)