CAS 1192835-55-4 is the registry number for 8,9-Di-O-methyl-urolithin D. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
3,4-dihydroxy-8,9-dimethoxybenzo[c]chromen-6-one (CAS 1192835-55-4) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 3,4-dihydroxy-8,9-dimethoxybenzo[c]chromen-6-one. InChIKey: MWDKXHOUSQIHQP-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 3,4-dihydroxy-8,9-dimethoxybenzo[c]chromen-6-one |
| InChIKey | MWDKXHOUSQIHQP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=C(C(=C(C=C3)O)O)OC2=O)OC |
Computed by PubChem (NCBI)