CAS 1193389-32-0 is the registry number for 5-(2-Methyl-1,3-thiazol-4-yl)thiophene-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-carboxylic acid (CAS 1193389-32-0) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-carboxylic acid. InChIKey: TWXUVNYVLSBNHK-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 5-(2-methyl-1,3-thiazol-4-yl)thiophene-3-carboxylic acid |
| InChIKey | TWXUVNYVLSBNHK-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CS2)C(=O)O |
Computed by PubChem (NCBI)