CAS 855716-78-8 is the registry number for (2-Thien-2-yl-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid (CAS 855716-78-8) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid. InChIKey: PSWAJRIIRPRMQB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | PSWAJRIIRPRMQB-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)