Products 855716-78-8

CAS 855716-78-8 is the registry number for (2-Thien-2-yl-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid (CAS 855716-78-8) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid. InChIKey: PSWAJRIIRPRMQB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO2S2
Molecular weight225.3 g/mol
IUPAC name2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetic acid
InChIKeyPSWAJRIIRPRMQB-UHFFFAOYSA-N
SMILESC1=CSC(=C1)C2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)