CAS 209540-08-9 appears in our catalog under these names: 4-Methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylic acid, 95%, 4–Methyl–2–(2–thienyl)thiazole–5–carboxylic acid, 4-Methyl-2-(2-thienyl)-1,3-thiazole-5-carboxylic acid, 98%, 98%, 4-methyl-2-thien-2-yl-1,3-thiazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 5g, 1g, 100mg, 500mg, 25mg.
4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid (CAS 209540-08-9) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: DSMGYNWKEJBPKW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | DSMGYNWKEJBPKW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)