CAS 1489464-15-4 is the registry number for Methyl 2-(thiophen-2-yl)thiazole-4-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 100mg.
Methyl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate (CAS 1489464-15-4) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: methyl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate. InChIKey: UYTRNLIPONGALL-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | methyl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
| InChIKey | UYTRNLIPONGALL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=CS2 |
Computed by PubChem (NCBI)