CAS 863669-69-6 appears in our catalog under these names: 2-(2-(Thiophen-3-yl)-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(Thiophen-3-yl)-1,3-thiazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid (CAS 863669-69-6) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid. InChIKey: SRJPLNCSOGDLEC-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | SRJPLNCSOGDLEC-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)