CAS 2591-09-5 is the registry number for 2-(Vinylsulfonyl)benzo(d)thiazole, 95% mix TBC as stabilizer. Offered by: AmBeed. Available pack sizes: 10g.
2-ethenylsulfonyl-1,3-benzothiazole (CAS 2591-09-5) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 2-ethenylsulfonyl-1,3-benzothiazole. InChIKey: KQANLUPCSMZGHR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 2-ethenylsulfonyl-1,3-benzothiazole |
| InChIKey | KQANLUPCSMZGHR-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)C1=NC2=CC=CC=C2S1 |
Computed by PubChem (NCBI)