CAS 1193779-34-8 appears in our catalog under these names: Bupropion 3',4'-dichloro impurity, 95%, Bupropion Impurity 10(3,4-Chloro), 2-(tert-Butylamino)-3',4'-dichloropropiophenone hydrochloride, Bupropion impurity 4. Offered by: Combi-blocks, Hubei YoungXin, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 200mg, Get quote.
2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one (CAS 1193779-34-8) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one. InChIKey: MXUDEADPGZWZCH-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one |
| InChIKey | MXUDEADPGZWZCH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)Cl)Cl)NC(C)(C)C |
Computed by PubChem (NCBI)