CAS 174560-99-7 is the registry number for (1-(3,4-Dichlorobenzyl)piperidin-3-yl)methanol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
[1-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methanol (CAS 174560-99-7) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. IUPAC name: [1-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methanol. InChIKey: DSMFHKZBPHLJGD-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | [1-[(3,4-dichlorophenyl)methyl]piperidin-3-yl]methanol |
| InChIKey | DSMFHKZBPHLJGD-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC(=C(C=C2)Cl)Cl)CO |
Computed by PubChem (NCBI)