CAS 1073254-49-5 appears in our catalog under these names: Ketamine-(methyl-d3) Hydrochloride, D3-Ketamine hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile, D3-Ketamine hydrochloride. Offered by: TRC, HPC Standards. Available pack sizes: 50mg, 1x1ml, 1x10mg.
2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride (CAS 1073254-49-5) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 277.20 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride. InChIKey: VCMGMSHEPQENPE-NIIDSAIPSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 277.20 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride |
| InChIKey | VCMGMSHEPQENPE-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NC1(CCCCC1=O)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)