Products 1246815-97-3
CAS 1246815-97-3 appears in our catalog under these names: Ketamine–d4 (hydrochloride), Ketamine-D4 hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 500μg.
2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride (CAS 1246815-97-3) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride. InChIKey: VCMGMSHEPQENPE-SJSMECCZSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(methylamino)cyclohexan-1-one;hydrochloride |
| InChIKey | VCMGMSHEPQENPE-SJSMECCZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2(CCCCC2=O)NC)Cl)[2H])[2H].Cl |
Computed by PubChem (NCBI)