CAS 93307-24-5 appears in our catalog under these names: 4'–chloro–α–Pyrrolidinopropiophenone (hydrochloride), 4'-Chloro-alpha-pyrrolidinopropiophenone Hydrochloride. Offered by: GLPBio, TRC. Available pack sizes: 5mg, 250mg, 10mg, 50mg.
1-(4-chlorophenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride (CAS 93307-24-5) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride. InChIKey: PHDAQPTYJWNZGQ-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride |
| InChIKey | PHDAQPTYJWNZGQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)N2CCCC2.Cl |
Computed by PubChem (NCBI)