CAS 1193779-48-4 appears in our catalog under these names: Bupropion Impurity 11(3,5-Chloro), 1-(3,5-Dichlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(tert-butylamino)-1-(3,5-dichlorophenyl)propan-1-one (CAS 1193779-48-4) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3,5-dichlorophenyl)propan-1-one. InChIKey: ZKFFJBXJJFDBJM-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3,5-dichlorophenyl)propan-1-one |
| InChIKey | ZKFFJBXJJFDBJM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC(=C1)Cl)Cl)NC(C)(C)C |
Computed by PubChem (NCBI)