CAS 1195693-72-1 is the registry number for 7-Bromo-5-chloro-2-methyl-1,3-benzoxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromo-5-chloro-2-methyl-1,3-benzoxazole (CAS 1195693-72-1) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 7-bromo-5-chloro-2-methyl-1,3-benzoxazole. InChIKey: VQWPXYVMYURDNL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 7-bromo-5-chloro-2-methyl-1,3-benzoxazole |
| InChIKey | VQWPXYVMYURDNL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)