CAS 1195945-49-3 is the registry number for Methyl 2-fluoro-3-hydroxy-4-methoxybenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 2-fluoro-3-hydroxy-4-methoxybenzoate (CAS 1195945-49-3) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: methyl 2-fluoro-3-hydroxy-4-methoxybenzoate. InChIKey: OTSODGMSRREDQO-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | methyl 2-fluoro-3-hydroxy-4-methoxybenzoate |
| InChIKey | OTSODGMSRREDQO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)F)O |
Computed by PubChem (NCBI)