CAS 178449-63-3 is the registry number for 6-Chloro-3-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-3-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (CAS 178449-63-3) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 6-chloro-3-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde. InChIKey: GSNCCGDAPCLMRZ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 6-chloro-3-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| InChIKey | GSNCCGDAPCLMRZ-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=NC(=C(N12)C=O)Cl |
Computed by PubChem (NCBI)