Products 1197333-54-2
CAS 1197333-54-2 is the registry number for BRL 54443 (maleate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-but-2-enedioic acid;3-(1-methylpiperidin-4-yl)-1H-indol-5-ol (CAS 1197333-54-2) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;3-(1-methylpiperidin-4-yl)-1H-indol-5-ol. InChIKey: INGCLXPSKXSYND-BTJKTKAUSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;3-(1-methylpiperidin-4-yl)-1H-indol-5-ol |
| InChIKey | INGCLXPSKXSYND-BTJKTKAUSA-N |
| SMILES | CN1CCC(CC1)C2=CNC3=C2C=C(C=C3)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)