CAS 1197595-61-1 is the registry number for 2-(3,5-Dimethylisoxazol-4-yl)-N-(1H-1,2,4-triazol-3-yl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide (CAS 1197595-61-1) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide. InChIKey: OKKHHHZTIYHORJ-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O2 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(1H-1,2,4-triazol-5-yl)acetamide |
| InChIKey | OKKHHHZTIYHORJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CC(=O)NC2=NC=NN2 |
Computed by PubChem (NCBI)