CAS 141635-93-0 appears in our catalog under these names: 8-Hydroxy-6-methyl-4,6,7,8-tetrahydropyrimido[1,2-a]purin-10(1H)-one, 98%, 4,6,7,8-Tetrahydro-8-hydroxy-6-methylpyrimido(1,2-a)purin-10(3H)-one (Mixture of Diastereomers), >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
8-hydroxy-6-methyl-5,6,7,8-tetrahydro-1H-pyrimido[1,2-a]purin-10-one (CAS 141635-93-0) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 8-hydroxy-6-methyl-5,6,7,8-tetrahydro-1H-pyrimido[1,2-a]purin-10-one. InChIKey: UGJRDCQEZCPJPZ-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O2 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 8-hydroxy-6-methyl-5,6,7,8-tetrahydro-1H-pyrimido[1,2-a]purin-10-one |
| InChIKey | UGJRDCQEZCPJPZ-UHFFFAOYSA-N |
| SMILES | CC1CC(N2C(=O)C3=C(N=CN3)N=C2N1)O |
Computed by PubChem (NCBI)