CAS 49687-12-9 is the registry number for 1,3-Dimethyl-7,9-dihydro-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethyl-7,8-dihydro-6H-purino[7,8-a]imidazole-1,3-dione (CAS 49687-12-9) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 2,4-dimethyl-7,8-dihydro-6H-purino[7,8-a]imidazole-1,3-dione. InChIKey: IRBZSBWYQZJUJQ-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O2 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 2,4-dimethyl-7,8-dihydro-6H-purino[7,8-a]imidazole-1,3-dione |
| InChIKey | IRBZSBWYQZJUJQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N3CCNC3=N2 |
Computed by PubChem (NCBI)