CAS 22817-15-8 is the registry number for 4-([([Amino(imino)methyl]amino)(imino)methyl]amino)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid (CAS 22817-15-8) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid. InChIKey: SQVQYPFROZNYOG-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O2 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoic acid |
| InChIKey | SQVQYPFROZNYOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=C(N)N=C(N)N |
Computed by PubChem (NCBI)