CAS 1485736-90-0 appears in our catalog under these names: 2-(methyl({(1,2,4)triazolo(4,3-a)pyrazin-8-yl})amino)propanoic acid, 95%, 2-(Methyl({(1,2,4)triazolo(4,3-a)pyrazin-8-yl})amino)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propanoic acid (CAS 1485736-90-0) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 2-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propanoic acid. InChIKey: QHXYAYFOOJQLFZ-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O2 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 2-[methyl([1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]propanoic acid |
| InChIKey | QHXYAYFOOJQLFZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N(C)C1=NC=CN2C1=NN=C2 |
Computed by PubChem (NCBI)