CAS 31918-48-6 is the registry number for 4-(9H-Purin-6-ylamino)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(7H-purin-6-ylamino)butanoic acid (CAS 31918-48-6) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 4-(7H-purin-6-ylamino)butanoic acid. InChIKey: JDWUZDMRFMRTNW-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O2 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 4-(7H-purin-6-ylamino)butanoic acid |
| InChIKey | JDWUZDMRFMRTNW-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)NCCCC(=O)O |
Computed by PubChem (NCBI)