Products 31918-48-6

CAS 31918-48-6 is the registry number for 4-(9H-Purin-6-ylamino)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(7H-purin-6-ylamino)butanoic acid (CAS 31918-48-6) is a chemical compound with the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. IUPAC name: 4-(7H-purin-6-ylamino)butanoic acid. InChIKey: JDWUZDMRFMRTNW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11N5O2
Molecular weight221.22 g/mol
IUPAC name4-(7H-purin-6-ylamino)butanoic acid
InChIKeyJDWUZDMRFMRTNW-UHFFFAOYSA-N
SMILESC1=NC2=C(N1)C(=NC=N2)NCCCC(=O)O

Computed by PubChem (NCBI)