Products 1197964-92-3
CAS 1197964-92-3 appears in our catalog under these names: 6-Methyl-4-(4-methyl-1,3-thiazol-2-yl)-2,3-dihydropyridazin-3-one, 95%, 6-Methyl-4-(4-methyl-1,3-thiazol-2-yl)-2,3-dihydropyridazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-methyl-5-(4-methyl-1,3-thiazol-2-yl)-1H-pyridazin-6-one (CAS 1197964-92-3) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 3-methyl-5-(4-methyl-1,3-thiazol-2-yl)-1H-pyridazin-6-one. InChIKey: IYHYVHLPMRUFQP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 3-methyl-5-(4-methyl-1,3-thiazol-2-yl)-1H-pyridazin-6-one |
| InChIKey | IYHYVHLPMRUFQP-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)C(=C1)C2=NC(=CS2)C |
Computed by PubChem (NCBI)