CAS 1197965-65-3 appears in our catalog under these names: 3-(4-Aminophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 3-(4-Aminophenyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 95%, 95%, 3-(4-AMINOPHENYL)-1-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
3-(4-aminophenyl)-1-methylpyrazole-4-carboxylic acid (CAS 1197965-65-3) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 3-(4-aminophenyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: YVJTZYQAEADMNF-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 3-(4-aminophenyl)-1-methylpyrazole-4-carboxylic acid |
| InChIKey | YVJTZYQAEADMNF-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)