Products 1198098-03-1
CAS 1198098-03-1 appears in our catalog under these names: GSK-3β inhibitor 10, WAY–119064, GSK-3β inhibitor 10, 98.04%, (5Z)-2-Amino-5-[(3,4-dimethoxyphenyl)methylene]-4(5H)-thiazolone, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (CAS 1198098-03-1) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one. InChIKey: UAAYANCJZUULAF-POHAHGRESA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| InChIKey | UAAYANCJZUULAF-POHAHGRESA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\2/C(=O)NC(=N)S2)OC |
Computed by PubChem (NCBI)