CAS 861581-28-4 is the registry number for 2-Methoxy-6,8-dimethylquinoline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-methoxy-6,8-dimethylquinoline (CAS 861581-28-4) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2-methoxy-6,8-dimethylquinoline. InChIKey: OOJIMLXKNINTPP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-methoxy-6,8-dimethylquinoline |
| InChIKey | OOJIMLXKNINTPP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=CC(=N2)OC)C |
Computed by PubChem (NCBI)