CAS 119915-41-2 is the registry number for 3,4,6-Trifluoro-2-methylbenzoyl Chloride. Offered by: TRC. Available pack sizes: 1g.
3,4,6-trifluoro-2-methylbenzoyl chloride (CAS 119915-41-2) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 3,4,6-trifluoro-2-methylbenzoyl chloride. InChIKey: WXJXPXFAMJMQTF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 3,4,6-trifluoro-2-methylbenzoyl chloride |
| InChIKey | WXJXPXFAMJMQTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)