CAS 119916-08-4 appears in our catalog under these names: 4,6-Dibromo-3-fluoro-2-methyl-benzoic acid methyl ester, 95%, 4,6–Dibromo–3–fluoro–2–methyl–benzoic acid methylester, 4,6-Dibromo-3-fluoro-2-methyl-benzoic acid methylester 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
Methyl 4,6-dibromo-3-fluoro-2-methylbenzoate (CAS 119916-08-4) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: methyl 4,6-dibromo-3-fluoro-2-methylbenzoate. InChIKey: NCKAZFAODCSNBV-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | methyl 4,6-dibromo-3-fluoro-2-methylbenzoate |
| InChIKey | NCKAZFAODCSNBV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)Br)Br)C(=O)OC |
Computed by PubChem (NCBI)