CAS 1566900-03-5 appears in our catalog under these names: Methyl 2-bromo-2-(3-bromo-4-fluorophenyl)acetate, 95%, Methyl 2-bromo-2-(3-bromo-4-fluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Methyl 2-bromo-2-(3-bromo-4-fluorophenyl)acetate (CAS 1566900-03-5) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: methyl 2-bromo-2-(3-bromo-4-fluorophenyl)acetate. InChIKey: JDZXEBKAUYNVQO-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | methyl 2-bromo-2-(3-bromo-4-fluorophenyl)acetate |
| InChIKey | JDZXEBKAUYNVQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1)F)Br)Br |
Computed by PubChem (NCBI)