CAS 1823369-30-7 is the registry number for Methyl 5-bromo-4-(bromomethyl)-2-fluorobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 5-bromo-4-(bromomethyl)-2-fluorobenzoate (CAS 1823369-30-7) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: methyl 5-bromo-4-(bromomethyl)-2-fluorobenzoate. InChIKey: OEZJLPRXYNPFHE-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | methyl 5-bromo-4-(bromomethyl)-2-fluorobenzoate |
| InChIKey | OEZJLPRXYNPFHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1)Br)CBr)F |
Computed by PubChem (NCBI)