Products 1346674-62-1
CAS 1346674-62-1 appears in our catalog under these names: 2,6-Dibromo-4-fluorobenzyl acetate, 97%, 2,6-Dibromo-4-fluorobenzyl acetate, 98%, 2,6-Dibromo-4-fluorobenzyl Acetate, ≥97%, ≥97%, 2,6-DIBROMO-4-FLUOROBENZYL ACETATE, ≥97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
(2,6-dibromo-4-fluorophenyl)methyl acetate (CAS 1346674-62-1) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: (2,6-dibromo-4-fluorophenyl)methyl acetate. InChIKey: ACSZRXJPUQDJNW-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | (2,6-dibromo-4-fluorophenyl)methyl acetate |
| InChIKey | ACSZRXJPUQDJNW-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=C(C=C1Br)F)Br |
Computed by PubChem (NCBI)