CAS 1805122-86-4 appears in our catalog under these names: Ethyl 2,3-dibromo-6-fluorobenzoate, 95%, Ethyl 2,3-dibromo-6-fluorobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
Ethyl 2,3-dibromo-6-fluorobenzoate (CAS 1805122-86-4) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: ethyl 2,3-dibromo-6-fluorobenzoate. InChIKey: VPLPUNQYWAIXNX-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | ethyl 2,3-dibromo-6-fluorobenzoate |
| InChIKey | VPLPUNQYWAIXNX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1Br)Br)F |
Computed by PubChem (NCBI)