Products 1214347-22-4

CAS 1214347-22-4 is the registry number for Ethyl 3,6-dibromo-2-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 3,6-dibromo-2-fluorobenzoate (CAS 1214347-22-4) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: ethyl 3,6-dibromo-2-fluorobenzoate. InChIKey: WRANVGWBTDIUMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7Br2FO2
Molecular weight325.96 g/mol
IUPAC nameethyl 3,6-dibromo-2-fluorobenzoate
InChIKeyWRANVGWBTDIUMZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC(=C1F)Br)Br

Computed by PubChem (NCBI)