CAS 1214347-22-4 is the registry number for Ethyl 3,6-dibromo-2-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 3,6-dibromo-2-fluorobenzoate (CAS 1214347-22-4) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: ethyl 3,6-dibromo-2-fluorobenzoate. InChIKey: WRANVGWBTDIUMZ-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | ethyl 3,6-dibromo-2-fluorobenzoate |
| InChIKey | WRANVGWBTDIUMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)Br)Br |
Computed by PubChem (NCBI)