CAS 1199782-86-9 appears in our catalog under these names: 5-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95+%, 5-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g.
5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1199782-86-9) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: DSOVIXWSDACZQD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | DSOVIXWSDACZQD-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC=C2)F)N.Cl |
Computed by PubChem (NCBI)