CAS 119993-55-4 appears in our catalog under these names: Methyl cis-2-aminocyclopentanecarboxylate hydrochloride, 95%, Methyl cis–2–Aminocyclopentanecarboxylate Hydrochloride, (1R,2S)-rel-Methyl 2-aminocyclopentanecarboxylate hydrochloride 98%, (1R,2S),-rel-Methyl 2-aminocyclopentanecarboxylate hydrochloride, 98%, 98%, METHYL CIS-2-AMINOCYCLOPENTANECARBOXYLATE HCL, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Cis-methyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 119993-55-4) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-methyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: KXQFCNYQRWIKML-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-methyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | KXQFCNYQRWIKML-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)